![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1999. Santelices_1999_How many kinds of individual are there.pdf | 2018-09-05 09:53 | 362K | |
| 2005_Schaffelke Calidad del agua.pdf | 2018-09-05 09:53 | 400K | |
![[ ]](/icons/unknown.gif) | Aboal 2003.PDF | 2018-09-05 10:35 | 1.3M | |
| Algal ecology presentación.pdf | 2018-09-05 10:36 | 1.1M | |
| Anderson et.al. 2005.PDF | 2018-09-05 09:53 | 136K | |
| Ati-Hellal et. al. 2007.pdf | 2018-09-05 09:53 | 204K | |
| Ati-Hellal et al. 2007.pdf | 2018-09-05 09:53 | 204K | |
| Beltran-Magos et.al. 2005.PDF | 2018-09-05 10:36 | 2.1M | |
| Boyer,Fong,Artmitage2005.pdf | 2018-09-05 09:53 | 666K | |
| Burdick.pdf | 2018-09-05 09:53 | 53K | |
| Capitulo_5 cultivo algas macroscopicas.pdf | 2018-09-05 09:53 | 243K | |
| Caracterización de algas.pdf | 2018-09-05 09:53 | 279K | |
| Carol S. Thornber. Functional properties of the isomorphic biphasic algal life cycle. Integr. Comp. Biol.-2006-Thornber-605-14[1].pdf | 2018-09-05 09:53 | 157K | |
| Casares _ Faugeron. 2011..PDF | 2018-09-05 09:54 | 805K | |
| Cavalier2 Evolución clorop.pdf | 2018-09-05 09:53 | 76K | |
| Cetz Navarro etal. Nuevos registros de algas...Hidobiológica 2008.pdf | 2018-09-05 09:54 | 700K | |
| Cianciola etal. using molecular assisted alpha taxonomy...red algal biodiversity. Diversity 2010.pdf | 2018-09-05 09:54 | 240K | |
| Coleman. The role of recruitment in structuring patterns os small-scale spatial variability in intertidal and subtidal algal turfs. JEMBE 2003.pdf | 2018-09-05 09:54 | 193K | |
| Collado-Vides-et-al-2011bot.2011.046.pdf | 2018-09-05 10:36 | 1.1M | |
| Collado-Vides_et_al_2011-Bot.MAr-BlackPoint.pdf | 2018-09-05 09:54 | 507K | |
| Collado. Clonal architecture in marine macroalgae ecological and evolutionary perspectives. Evol Ecol. 2002.PDF | 2018-09-05 09:54 | 250K | |
| Contenido FAO.pdf | 2018-09-05 09:54 | 320K | |
| Costa etal. Spatial and Seasonal Distribution of Seaweeds on Coral Reefs from Brazil Botanica Marina 2002.pdf | 2018-09-05 09:54 | 309K | |
| Cui et.al.2010.PDF | 2018-09-05 09:54 | 344K | |
| D. Carol S. Thornber. Functional properties of the isomorphic biphasic algal life cycle. Integr. Comp. Biol.-2006-Thornber-605-14[1].pdf | 2018-09-05 09:54 | 157K | |
| Dethier _ Williams. Seasonal stresses shift optimal intertidal algae habitats. Mar Biol 2009.pdf | 2018-09-05 09:54 | 674K | |
| Diaz-Pulido_McCook 2008.pdf | 2018-09-05 09:54 | 773K | |
| Disiccation protection.PDF | 2018-09-05 09:54 | 558K | |
| Distribucion macroalgas Mexico.pdf | 2018-09-05 09:54 | 147K | |
| Diversity-nutrients_macroalgae2004.pdf | 2018-09-05 09:54 | 202K | |
| Duarte_1990[1].pdf | 2018-09-05 09:54 | 497K | |
| EPA2011_final_report_v2.0_-_nutirents_algae.pdf | 2018-09-05 09:54 | 612K | |
| Eighteenth_International_Seaweed_Symposium__Proceedings_of_the_Eighteenth_International_Seaweed_Symposium_held_in_Bergen__Norway__20___25_June_2004__D.pdf | 2018-09-05 10:38 | 14M | |
| Fei2004.PDF | 2018-09-05 09:54 | 85K | |
| Filogenia de Algas, libro.pdf | 2018-09-05 09:54 | 98K | |
| Flujos arriba abajo.pdf | 2018-09-05 09:54 | 135K | |
| Fogg_Harmful_Algae(2002).pdf | 2018-09-05 09:54 | 41K | |
| Fong-bioindicators_2008[1].pdf | 2018-09-05 09:54 | 489K | |
| Fong06-EpiphyteMAShift.pdf | 2018-09-05 09:54 | 165K | |
| Frangoudes 2011.pdf | 2018-09-05 09:54 | 203K | |
| GRIMM clorofila.PDF | 2018-09-05 09:55 | 306K | |
| Godsell2005_disturbance_canopy_macroalgae.pdf | 2018-09-05 09:54 | 239K | |
| Golberg etal. Adaptative cluster sampling rare macrolagae. Mar. Biol. 2007.pdf | 2018-09-05 09:54 | 188K | |
| Gordon Æ S. H. Brawley. 2004. Liberación de espo.pdf | 2018-09-05 09:55 | 306K | |
| Gray_et_al_2000_nutrient_assimilative.pdf | 2018-09-05 09:55 | 162K | |
| Grzebyk origen plastidio.pdf | 2018-09-05 10:39 | 1.1M | |
| Hauer2010.PDF | 2018-09-05 09:55 | 217K | |
| History currents.PDF | 2018-09-05 09:55 | 379K | |
| IndiaFinal-AT_Mono_ADD[1].pdf | 2018-09-05 10:39 | 3.9M | |
| Interactions Fucus - Mazzaella.PDF | 2018-09-05 10:39 | 1.2M | |
| J. Navarro etal. UVB effects on early developmental stages of commercially important carragenophta. J. app. Phy. 2008.PDF | 2018-09-05 09:55 | 241K | |
| Jompa y McCook Coral algal competition.pdf | 2018-09-05 09:55 | 1.0M | |
| Kang etal. Food web structure of a restored macroalgal bed...Mar Biol. 2008.pdf | 2018-09-05 09:55 | 770K | |
| Kapraun2005.pdf | 2018-09-05 09:55 | 363K | |
| Kapraun2005algas.pdf | 2018-09-05 09:55 | 363K | |
| Kim. Interactions Fucus - Mazzaella.PDF | 2018-09-05 10:42 | 1.2M | |
| Liman. Competition macroalgae-corals herbivore exclusion...Coral Reefs 2001.pdf | 2018-09-05 09:55 | 347K | |
| Lopez Norma_ Hilda Leon.pdf | 2018-09-05 10:46 | 4.2M | |
| Lubchenko.pdf | 2018-09-05 10:46 | 1.6M | |
| Lu et.al.2010.PDF | 2018-09-05 09:55 | 157K | |
| MACROALGAL Necchi-Junior_20O.pdf | 2018-09-05 09:55 | 111K | |
| MARINA - R. Gordon Æ S. H. Brawley. 2004. Liberación de espo.pdf | 2018-09-05 09:55 | 306K | |
| MOESRUPT Fiolog algas.PDF | 2018-09-05 09:55 | 95K | |
| Macroalgas, macroinvertebrados, disturbio.pdf | 2018-09-05 09:55 | 750K | |
| Macroalgas, variación genética, isoenzimas.pdf | 2018-09-05 09:55 | 280K | |
| Macroalgas con ciclo de alternancia vs. un banco de semillas.pdf | 2018-09-05 10:46 | 1.0M | |
| Macroalgas eutroficación, trópicos, Taiwán.pdf | 2018-09-05 09:55 | 402K | |
| Mejía Niño _ Garzón Ferrerira. Dinámica de las interacciones alga-coral...Bol. Invest. Mar. Cost. 2003.pdf | 2018-09-05 10:47 | 1.0M | |
| Metabolismo algal, Raven.pdf | 2018-09-05 09:55 | 134K | |
| Microalgas, variación estacional, distribución, sedimentos, .pdf | 2018-09-05 09:55 | 187K | |
| Millar_Payri,2006.pdf | 2018-09-05 09:56 | 966K | |
| Monogrph. applied mar. Algae India.pdf | 2018-09-05 09:56 | 167K | |
| New melobesiod alga.pdf | 2018-09-05 10:49 | 20M | |
| Padilla et.al.2010.PDF | 2018-09-05 09:56 | 436K | |
| PalacinEsp1.pdf | 2018-09-05 09:56 | 207K | |
| Patrones fractales del asentamiento algal.pdf | 2018-09-05 09:56 | 193K | |
| Peterson___Fry.pdf | 2018-09-05 10:49 | 1.4M | |
| Piriz et.al.2003.PDF | 2018-09-05 09:56 | 177K | |
| Pizarro etal. An economic assessment of algal turf scrubber technology for treatment of dairy manure effluent.pdf | 2018-09-05 09:56 | 254K | |
| Portada_Contenido_Manual[1].pdf | 2018-09-05 09:56 | 101K | |
| Purton cloroplas-algas.pdf | 2018-09-05 09:56 | 141K | |
| Radiación fotosintéticamente activa.pdf | 2018-09-05 09:56 | 719K | |
| Review Classification.pdf | 2018-09-05 09:56 | 132K | |
| Santelices. 2004.PDF | 2018-09-05 09:57 | 827K | |
| Santelices. Implications of clonal and chimeric-type thallus organization on seaweed.PDF | 2018-09-05 09:56 | 74K | |
| Santelices_1999_How many kinds of individual are there.pdf | 2018-09-05 09:57 | 362K | |
| Santelices et.al.1995.PDF | 2018-09-05 10:51 | 1.4M | |
| Santelices etal. A bank of microscopic.PDF | 2018-09-05 10:51 | 1.4M | |
| Sherwood.pdf | 2018-09-05 09:57 | 167K | |
| Tittley _ Neto. A provisional classification of algal characterised rocky shore biotopes in Azores. Hydrobiologia 2000.pdf | 2018-09-05 09:57 | 45K | |
| Toth etal. Mesoherbivores reduce net growth...seaweeds. oecologia. 2007.pdf | 2018-09-05 09:57 | 531K | |
| Trono. Seaweeds.pdf | 2018-09-05 09:57 | 627K | |
| Tseng2001.PDF | 2018-09-05 09:57 | 78K | |
| Turf vs erizos.pdf | 2018-09-05 09:57 | 472K | |
| Valdivia _ de la Guardia 2004.pdf | 2018-09-05 09:57 | 227K | |
| VanAlstyne et.al. 2001.PDF | 2018-09-05 09:57 | 314K | |
| Verlag 2003.PDF | 2018-09-05 09:57 | 228K | |
| Wright etal. Native species behaviour mitigates the impact of habitat forming incasive seawedd. Oecologia 2010.pdf | 2018-09-05 09:57 | 341K | |
| Zhou et.al.2010.PDF | 2018-09-05 09:57 | 247K | |
| catalogo_algas Salvador.pdf | 2018-09-05 10:36 | 3.5M | |
| disturbance_eutrophication-2207.pdf | 2018-09-05 09:54 | 603K | |
| dominancia ecologica.pdf | 2018-09-05 10:37 | 3.5M | |
| farming Kappaphycus longline.pdf | 2018-09-05 09:54 | 122K | |
| grazers-nutrients2004.pdf | 2018-09-05 09:55 | 144K | |
| kumar_Dhar 2007.PDF | 2018-09-05 10:43 | 22M | |
| lapoint. ALGAL BLOOMS.PDF | 2018-09-05 10:44 | 2.2M | |
| macroalgas e invertebrados asociados.pdf | 2018-09-05 09:55 | 119K | |
| mcMinn etal. In situ net primary productivity and photosynthesis of Antartic sea ice algal, phytoplancton and nenthic algal communities. Mar Biol 2010.pdf | 2018-09-05 09:56 | 621K | |
| pices10_2002.pdf | 2018-09-05 10:50 | 9.8M | |
| respalgas.pdf | 2018-09-05 09:56 | 297K | |
| revision1.pdf | 2018-09-05 09:56 | 30K | |
| santelices _oliger 1981.pdf | 2018-09-05 09:57 | 809K | |
| seaweed farming impacts in tropic.pdf | 2018-09-05 10:51 | 1.0M | |
| subtidalassamblages Australia.pdf | 2018-09-05 09:57 | 561K | |
| variación antifouling.pdf | 2018-09-05 09:57 | 149K | |
|
|---|