![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Ávila etal. luga negra Sarcothalia... Hydrob 1996.pdf | 2018-09-05 10:35 | 11M | |
| 1994. Muñoz _ Santelices. Quantification of the effects of sporeling coalescence... J. Phycol. 1994.pdf | 2018-09-05 09:48 | 580K | |
| 1996. Santelices etal. Sporeling coalescence and intraclonal variation... J. Phycol. 1996.pdf | 2018-09-05 09:50 | 5.1M | |
| 1999. Meneses, Santelices _ Sánchez. Growth-related intraclonal genetic changes in G. chilensis. Mar Biol 1999.pdf | 2018-09-05 09:48 | 206K | |
| 1999. Meneses _ Santelices. Strain selection and genetic variation in Gracilaria chilensis. Gracilariales, Rhodophyta. J. App. Phy. 1999.pdf | 2018-09-05 09:48 | 109K | |
| 129869.pdf | 2018-09-05 09:48 | 1.6M | |
| Alveal et.al. 1997.pdf | 2018-09-05 09:48 | 586K | |
![[ ]](/icons/unknown.gif) | Anderson et.al.1999.PDF | 2018-09-05 09:48 | 163K | |
| Anderson et al. 2008.pdf | 2018-09-05 09:48 | 569K | |
| Avila et.al. 1999.pdf | 2018-09-05 09:48 | 554K | |
| Avila etal. Economic feasibility...J.A.Phy. 1999.pdf | 2018-09-05 09:48 | 299K | |
| Batelli _ Rindi 2008.pdf | 2018-09-05 09:48 | 410K | |
| Bell 1999.PDF | 2018-09-05 09:48 | 122K | |
| Bellegrove _ Aoki 2006.pdf | 2018-09-05 09:52 | 1.7M | |
| Boraso_Zaixso.PDF | 2018-09-05 09:52 | 1.7M | |
| Bouza et.al. 2006.pdf | 2018-09-05 09:48 | 171K | |
| Bouzon et.al. 2003.PDF | 2018-09-05 09:48 | 330K | |
| Buschmann et.al. 1997.PDF | 2018-09-05 09:53 | 1.2M | |
| Buschmann et.al. 2001.pdf | 2018-09-05 09:48 | 364K | |
| CHONDRUS.PDF | 2018-09-05 09:48 | 266K | |
| CSCROS~1.PDF | 2018-09-05 09:48 | 60K | |
| CTMBREAR-186 Gelidium.pdf | 2018-09-05 09:49 | 261K | |
| Calderón etal. Notas sobre Gigartinaceae. 1 mazzaella. Rev. peru biol. 2010.PDF | 2018-09-05 09:48 | 648K | |
| Candia et.al.1999.PDF | 2018-09-05 09:48 | 104K | |
| Capo et.al.1999.PDF | 2018-09-05 09:48 | 72K | |
| Carmona y Santos. Ecophysiology Gelidium sesquipedale. J. Phycol. 2006.pdf | 2018-09-05 09:48 | 329K | |
| Carrington etal. Life history...Chondrus...J. of Phy. 2001.pdf | 2018-09-05 09:48 | 91K | |
| Cassano et.al. 2008.PDF | 2018-09-05 09:48 | 141K | |
| Cassano etal. Evidence for the conspecificity of Palisada papillosa with P. perforata (Ceramiales...Phycol 2009.pdf | 2018-09-05 09:53 | 1.8M | |
| Chai-Ling etal. Profiling the transcriptome of Gracialaria hangii in response to light deprivation. Mar Biothechnol 2009.pdf | 2018-09-05 09:48 | 145K | |
| Chinos Ch. crispus...2007.pdf | 2018-09-05 09:49 | 397K | |
| Chondrus, predominancia gametofítica.PDF | 2018-09-05 09:49 | 266K | |
| Comparison of three technics.PDF | 2018-09-05 09:48 | 141K | |
| Contrastig effects turf algae Jompa-McCook 2003.pdf | 2018-09-05 09:49 | 1.0M | |
![[DIR]](/icons/folder.gif) | Coralinas/ | 2018-10-16 23:13 | - | |
| Craig W. Schneider. Revisión clasificación Rhodophyta...Bot. Mar. 2007.PDF | 2018-09-05 09:48 | 384K | |
| DESARROLLO DE C. WRIGHTII.pdf | 2018-09-05 09:49 | 459K | |
| Daweset.al.1999.PDF | 2018-09-05 09:48 | 75K | |
| Daweset.al.2000.PDF | 2018-09-05 09:49 | 231K | |
| Delaney 2011.pdf | 2018-09-05 09:49 | 192K | |
| Delivopoulus. Ultrastructure cystocarp. Mar. Biol. 2003.pdf | 2018-09-05 09:55 | 1.2M | |
| Diaz-Larrea et.al. 2007.PDF | 2018-09-05 09:49 | 126K | |
| Donelle etal. Population dynamic sponges red algae. JEMBE.pdf | 2018-09-05 09:49 | 447K | |
| Drachiella, Delesseriaceae.pdf | 2018-09-05 09:49 | 1.0M | |
| Estructura genética en poblaciones de Gelidium.pdf | 2018-09-05 09:49 | 44K | |
| Falcao et.al.2010.PDF | 2018-09-05 09:49 | 206K | |
| Faugeron et al 2001 (J Phycol). Hierarchical....M. laminarioides.pdf | 2018-09-05 09:49 | 152K | |
| Freshwater _ Bailey. A multigene phylogeny Gelidiales. J. of App. Phycology. 1998.pdf | 2018-09-05 09:49 | 83K | |
| Gómez _ Westermeier. Frond regrowth from basal disk in Iredaea...Mar. Ecol. Progress Ser. 1991.pdf | 2018-09-05 09:50 | 806K | |
| G. canariensis poblaciones.pdf | 2018-09-05 09:49 | 63K | |
| G. floridanum ultraestuc esporas.pdf | 2018-09-05 09:56 | 3.1M | |
| G. omanense BotMar_47_64.pdf | 2018-09-05 09:49 | 562K | |
| G. sesquip. poblacional.pdf | 2018-09-05 09:49 | 125K | |
| G. sesquipedale.pdf | 2018-09-05 09:49 | 221K | |
| Gabrielson _ Garbary. Cladistic analysis Rhodophyta orders. Br. J. of Phy. 1987.pdf | 2018-09-05 09:49 | 933K | |
| Gelidiella acerosa cultivo.pdf | 2018-09-05 09:58 | 2.1M | |
| Gelidiella ligulata Japón.pdf | 2018-09-05 09:59 | 1.6M | |
| Gelidiella tenuissima.pdf | 2018-09-05 09:59 | 1.8M | |
| Gelidiella y Pterocladiell de Japón.pdf | 2018-09-05 09:49 | 164K | |
| Gelidium canariense RAPDs.pdf | 2018-09-05 09:49 | 171K | |
| Gelidium crinale.PDF | 2018-09-05 10:00 | 3.0M | |
| Gelidium crinale. cDNA.pdf | 2018-09-05 09:50 | 540K | |
| Gelidium omanense Wynne _ Freshwater. 2004.pdf | 2018-09-05 09:49 | 562K | |
| Gelidium subfastigiata.pdf | 2018-09-05 10:00 | 3.1M | |
| Growth of the commercial carrageenophyte Sarcothalia crispata -Rhodophyta Gigartinales- on suspended culture in central Chile.pdf | 2018-09-05 09:49 | 84K | |
| Guiry _ Womersley. Gelidiella minima. Br. Phycol. Jour. 1992.pdf | 2018-09-05 10:03 | 1.8M | |
| Guzmán-Urióstegui-Robledo. Factores affecting sporulation...carposporophytes...Hydrobiologia 1999.pdf | 2018-09-05 09:49 | 189K | |
| Guzman-Uriostegui_Robledo1999.PDF | 2018-09-05 09:49 | 189K | |
| H. Craig W. Schneider. Revisión clasificación Rhodophyta...Bot. Mar. 2007.PDF | 2018-09-05 09:49 | 384K | |
| Hannach _ Santelices. Ecological diferences betwee ...I. laminarioides. Mar Ecol Prog Ser 1985.pdf | 2018-09-05 10:14 | 1.3M | |
| Harper _ Saunders. Molecular...Florideophyceae. J. Phycol. 2001.pdf | 2018-09-05 09:50 | 403K | |
| Hildenbrandiales, sistemática.pdf | 2018-09-05 09:49 | 468K | |
| Hommersand _ Fredericq. Recent developments in the systematics of Gigartinaceae....PDF | 2018-09-05 10:15 | 5.6M | |
| Hommersand _ Frederiq Biogeografía S.Africa 2005.pdf | 2018-09-05 09:50 | 579K | |
| Hwan etal. Defining the major lineages of red algae Rhodophyta. J. Phycol. 2006.pdf | 2018-09-05 09:50 | 325K | |
| I. Santelices etal. The effects of coalescence...Mazzaella laminarioides. J. Appl. Phyc. 2011.PDF | 2018-09-05 09:50 | 394K | |
| Inorganic nutrition in pond cultivated Gracilaria conferta -Rhodophyta- nitrogen phosphate and sulfate.pdf | 2018-09-05 09:50 | 293K | |
| Iridaea cordata UVB.PDF | 2018-09-05 09:50 | 484K | |
| Jmba03Scrosati.pdf | 2018-09-05 09:50 | 165K | |
| Jmba03Scrosati. proporción gametofitos=esporofitos.pdf | 2018-09-05 09:50 | 165K | |
| Kakita et.al.1999.PDF | 2018-09-05 09:50 | 82K | |
| Lim et.al.2001.PDF | 2018-09-05 09:50 | 152K | |
| Lindstrom. Cryptic diversity...Mastocarpus papillatus. J. of Phy. 2008.pdf | 2018-09-05 09:50 | 263K | |
| Liuet.al.2000.PDF | 2018-09-05 09:50 | 134K | |
| Lluisa_Ragan1997.PDF | 2018-09-05 09:50 | 68K | |
| Lluisma_Ragan1999.PDF | 2018-09-05 09:50 | 252K | |
| MAZZAELLA.PDF | 2018-09-05 09:50 | 192K | |
| MECHAN~1.PDF | 2018-09-05 09:50 | 1.0M | |
| Macchiavello et.al.1999.PDF | 2018-09-05 09:50 | 41K | |
| Maggs _ Guiry. Gelidiella calcicola. Br. Phycol. Jour. 1987.pdf | 2018-09-05 10:21 | 2.6M | |
| Maggs et.al..pdf | 2018-09-05 10:22 | 1.6M | |
| Mastophoroideae polifelética.pdf | 2018-09-05 10:23 | 2.2M | |
| Mehta et.al.2010.PDF | 2018-09-05 09:50 | 137K | |
| Mei _ Schiel. Survival strategies... subjected to sediment deposition and grazing pressure. New Zealand J. of Marina _ freshwater Res. 2007.pdf | 2018-09-05 09:50 | 406K | |
| Molecular phylogeny of marine red algae.pdf | 2018-09-05 10:25 | 1.2M | |
| Morfol y sistem G. tenuissima.pdf | 2018-09-05 10:26 | 1.8M | |
| Mudge _ Scrosati. Effects of wave exposure on the proportion of gametophytes and tetrasporophytes of Mazzaella oregona.PDF | 2018-09-05 09:50 | 164K | |
| Nuevas spp. Gelidium Japón.pdf | 2018-09-05 09:50 | 217K | |
| Ordenes de Rhodophyta.pdf | 2018-09-05 09:50 | 93K | |
| Otaiza etal. Seasonal chages in abundance...J.A.Phy. 2001.pdf | 2018-09-05 09:50 | 198K | |
| P. capillacea crecimiento.pdf | 2018-09-05 09:50 | 382K | |
| P. capillacea dominancia apical.pdf | 2018-09-05 10:26 | 1.4M | |
| PALMA et.al. 2007.pdf | 2018-09-05 09:50 | 119K | |
| PUESCH~1.PDF | 2018-09-05 10:28 | 4.8M | |
| Pacheco etal. Reclutamiento G. robustum. Ciencias marinas. 2001.pdf | 2018-09-05 09:50 | 149K | |
| Pang2010.PDF | 2018-09-05 09:51 | 137K | |
| Pereira et.al. 2009.PDF | 2018-09-05 10:27 | 2.6M | |
| Phillips. Ecological differences betwee the isomorphic phases of M. lilacina.PDF | 2018-09-05 10:27 | 3.2M | |
| Porphyra morfogénesis.pdf | 2018-09-05 09:50 | 209K | |
| Provan etal. Universal primers Chlorophyta and Rhodophyta. Eur. J. Phycol. 2004.pdf | 2018-09-05 09:51 | 285K | |
| Pterocladiella apices.pdf | 2018-09-05 10:27 | 1.4M | |
| Ptilophora spp nuevas sp.pdf | 2018-09-05 10:27 | 1.2M | |
| Ragan. Rhodophya phylogeny.pdf | 2018-09-05 10:28 | 1.2M | |
| Ramet dynamics.PDF | 2018-09-05 09:50 | 232K | |
| Red algal farming in Chile.pdf | 2018-09-05 09:51 | 334K | |
| Rhodophyta, filogenia molecular.pdf | 2018-09-05 10:28 | 1.2M | |
| Rindi _ Cinelli. Phenology and small scale distribution...red algae...Europ. J. phycol. 2000.pdf | 2018-09-05 09:51 | 438K | |
| Romo etal. Growth of the commercial carrageenophyte...J.A.Phy. 2001.pdf | 2018-09-05 09:51 | 84K | |
| Ryder etal. Effect of water motion on the cultivation of the economic seaweed G. parvispora...Hawaii. Aquculture 2004.pdf | 2018-09-05 09:51 | 158K | |
| SAfrPhyllophoraceae.pdf | 2018-09-05 09:51 | 734K | |
| Saez etal 2008 Discos secundarios de crecimiento C. chamisoi.pdf | 2018-09-05 09:51 | 177K | |
| Santelices _ Alvarado. 2008.PDF | 2018-09-05 09:52 | 850K | |
| Santelices _ Alvarado. DEMOGRAPHIC CONSEQUENCES OF COALESCENCE IN SPORELING POPULATIONS OF MAZZAELLA LAMINARIOIDES. j. pHYCOL. 2008.PDF | 2018-09-05 09:52 | 850K | |
| Santelices _ Norambuena. A harvesting strategy for I. laminarioides in Central Chile. Hydrobiol. 1987.pdf | 2018-09-05 10:28 | 3.3M | |
| Santelices et.al. 2003 (2).pdf | 2018-09-05 10:28 | 1.2M | |
| Santelices et.al. 2003.PDF | 2018-09-05 10:28 | 1.3M | |
| Santelices et.al. 2004.pdf | 2018-09-05 09:51 | 502K | |
| Santelices et.al. 2011.PDF | 2018-09-05 09:51 | 394K | |
| Santelices etal. Field testing.pdf | 2018-09-05 10:29 | 1.3M | |
| Santelices etal. Field testing of inter and itraspecific coalescence....PDF | 2018-09-05 10:29 | 1.3M | |
| Santelices etal. Field testing of inter and itraspecific coalescence... Mar ecol progr Ser 2003.PDF | 2018-09-05 10:28 | 1.3M | |
| Santelices etal. The effects of coalescence...Mazzaella laminarioides. J. Appl. Phyc. 2011.PDF | 2018-09-05 09:51 | 394K | |
| Santelices etal. The fate of overgrown germlings in coalescing Rhodophyta. Phycologia. 2004.pdf | 2018-09-05 09:51 | 502K | |
| Santelices et al 1999.pdf | 2018-09-05 10:28 | 1.1M | |
| Santelices etal Contact responses between spors and sporelings...Marin Biology 2003-1.pdf | 2018-09-05 10:28 | 1.2M | |
| Saunders....2000.pdf | 2018-09-05 09:51 | 135K | |
| Schneider_Lane2005b.pdf | 2018-09-05 09:52 | 483K | |
| Scrosati. 1996 1a. pag..pdf | 2018-09-05 09:52 | 829K | |
| Scrosati. Crowding in clonal seaweeds...Aquatic Botany 2006.pdf | 2018-09-05 09:52 | 346K | |
| Scrosati. Demography on genets of clonal red seaweed. Hidrobiológica. 2001.PDF | 2018-09-05 09:52 | 450K | |
| Scrosati. Interannual variation of abundance.pdf | 2018-09-05 09:52 | 65K | |
| Scrosati. Population structure Mazzaella...Bot. Mar. 1998.PDF | 2018-09-05 09:52 | 1.0M | |
| Scrosati. The relationships between stand biomass and frond density in the clonal algae Mazzaella cornucopiae. Hydrobiol. 1996.pdf | 2018-09-05 10:30 | 5.2M | |
| Scrosati _ DeWreede. Demographic models to simulate the stable ratio between ecologically similar gametophytes and tetrasporophytes...Phyc. Resear. 1999.PDF | 2018-09-05 09:52 | 60K | |
| Scrosati _ Mudge. Effects of elevation, wave exposure _ year...Hydrobiol. 2004.pdf | 2018-09-05 09:52 | 173K | |
| Scrosati _ Mudge. Persistence of gametophyte...Hydrobiol. 2004.pdf | 2018-09-05 09:52 | 190K | |
| Senties_Diaz-Larrea 2008.PDF | 2018-09-05 09:52 | 37K | |
| Shaughnessy. Allometry in sister species Mazzaella.PDF | 2018-09-05 09:52 | 339K | |
| Shaughnessy 2004.PDF | 2018-09-05 09:52 | 339K | |
| Shaughnessy _ DeWreede. Size survival.PDF | 2018-09-05 09:52 | 342K | |
| Shimada etal. Phylogenetic...Acanthopeltis, Yatabella. Phycologia 1999.pdf | 2018-09-05 09:52 | 945K | |
| Sirodotia huiil-JCJ-GMZ-ONJ.pdf | 2018-09-05 09:52 | 197K | |
| Sistemática molecular de algas rojas.pdf | 2018-09-05 10:30 | 1.6M | |
| Size survival.PDF | 2018-09-05 09:52 | 342K | |
| Smit_Bolton1999.PDF | 2018-09-05 09:52 | 62K | |
| Sosa, etal. Genetic structure populations Gelidium spp. J.App.Phycol.1998.pdf | 2018-09-05 09:52 | 44K | |
| Sylnain etal. Reduced genetic diversity...J. Phycol 2004.pdf | 2018-09-05 09:52 | 306K | |
| The red alga Porphyra dioica as a fish feed ingredient for rainbow trout Oncorhynchus mykiss effects on growth feed efficiency and carcass composition.pdf | 2018-09-05 09:52 | 154K | |
| Trends in bryophyte populations . Mazzaella model.PDF | 2018-09-05 10:31 | 1.9M | |
| Tronchin_2006.pdf | 2018-09-05 09:52 | 272K | |
| Tronchin et.al. 2003.PDF | 2018-09-05 10:32 | 3.0M | |
| Tronchin etal. Reassessement and reclassification...Bot. Mar. 2002.pdf | 2018-09-05 09:53 | 580K | |
| Ultraestructura esporas G. floridanum.pdf | 2018-09-05 09:53 | 665K | |
| Utilidad estudios moleculares rodofitas.pdf | 2018-09-05 09:53 | 79K | |
| Vásquez _ Vega. Chondracanthus chamissoi...J.A.Phy. 2001.pdf | 2018-09-05 09:53 | 213K | |
| Variación intraespecífica G. pusillum.pdf | 2018-09-05 09:52 | 126K | |
| Vasquez_Vega_2001_JApPhyc.pdf | 2018-09-05 10:32 | 9.4M | |
| Vasquez etal. Biomass, Rep. phenol. _ chem. charact...Bot. Mar. 1998.pdf | 2018-09-05 10:32 | 7.5M | |
| Vasquezetal1998botmar.pdf | 2018-09-05 10:33 | 7.5M | |
| Vega_Meneses(2001)BotMar.pdf | 2018-09-05 09:52 | 148K | |
| Vera et.al. 2008.pdf | 2018-09-05 09:53 | 274K | |
| Wakibia et.al.2001.PDF | 2018-09-05 09:53 | 225K | |
| Weinberger_Friedlander2000.PDF | 2018-09-05 09:53 | 63K | |
| Westermeier et.al. 1999.PDF | 2018-09-05 09:53 | 462K | |
| Xiao et al. 2010.pdf | 2018-09-05 09:53 | 555K | |
| Zamorano _ Westermier. Phenology of G. Skottsbergii. Ancud. Hydrobiol 1996.pdf | 2018-09-05 10:33 | 5.3M | |
| Zuccarello _ West. Multiple cryptic species...J. Phycol. 2008.pdf | 2018-09-05 09:53 | 412K | |
| effect of light _ temp C.chamissoi.pdf | 2018-09-05 09:49 | 80K | |
| m250p091.pdf | 2018-09-05 10:21 | 1.3M | |
| primers Rhodophyta.pdf | 2018-09-05 09:51 | 285K | |
| vegetative propag. vs spores C. Chamissoi.pdf | 2018-09-05 09:53 | 678K | |
| wilcoxet.al.2001.PDF | 2018-09-05 09:53 | 72K | |
|
|---|