![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Johnet.al2004.pdf | 2018-09-05 10:42 | 67M | |
![[ ]](/icons/layout.gif) | Le Jolis.pdf | 2018-09-05 10:46 | 38M | |
![[ ]](/icons/layout.gif) | Maggs. Algal Spores.pdf | 2018-09-05 10:47 | 30M | |
![[ ]](/icons/layout.gif) | Taylor 1945 completo.pdf | 2018-09-05 10:53 | 27M | |
![[ ]](/icons/unknown.gif) | kumar_Dhar 2007.PDF | 2018-09-05 10:43 | 22M | |
![[ ]](/icons/layout.gif) | Flora de ríos.pdf | 2018-09-05 10:39 | 21M | |
![[ ]](/icons/layout.gif) | New melobesiod alga.pdf | 2018-09-05 10:49 | 20M | |
![[ ]](/icons/layout.gif) | Ponce-Márquez etal. Estudio citogenético de macroalgas marinas con posibilidades de explotación. Oceanología 1997.pdf | 2018-09-05 10:51 | 15M | |
![[ ]](/icons/layout.gif) | unraveling algae.pdf | 2018-09-05 10:54 | 14M | |
![[ ]](/icons/layout.gif) | Eighteenth_International_Seaweed_Symposium__Proceedings_of_the_Eighteenth_International_Seaweed_Symposium_held_in_Bergen__Norway__20___25_June_2004__D.pdf | 2018-09-05 10:38 | 14M | |
![[ ]](/icons/unknown.gif) | Algae Anatomy Biochemistry_ Biotechnology 2007.PDF | 2018-09-05 10:36 | 10M | |
![[ ]](/icons/unknown.gif) | Algae Anatomy Biochemistry_ Biotechnology 2006.PDF | 2018-09-05 10:35 | 10M | |
![[ ]](/icons/layout.gif) | pices10_2002.pdf | 2018-09-05 10:50 | 9.8M | |
![[ ]](/icons/layout.gif) | Parmales_JPhycol2003.pdf | 2018-09-05 10:49 | 8.4M | |
![[ ]](/icons/layout.gif) | Suplemento . Phycol..pdf | 2018-09-05 10:52 | 7.1M | |
![[ ]](/icons/layout.gif) | Nuevas combinaciones algas.pdf | 2018-09-05 10:49 | 6.9M | |
![[ ]](/icons/layout.gif) | Lopez Norma_ Hilda Leon.pdf | 2018-09-05 10:46 | 4.2M | |
![[ ]](/icons/unknown.gif) | mIllar 2004.PDF | 2018-09-05 10:48 | 4.0M | |
![[ ]](/icons/layout.gif) | IndiaFinal-AT_Mono_ADD[1].pdf | 2018-09-05 10:39 | 3.9M | |
![[ ]](/icons/unknown.gif) | Inf._20Gigartina_20Huanchaco[1]Perú.PDF | 2018-09-05 10:39 | 3.9M | |
![[ ]](/icons/layout.gif) | dominancia ecologica.pdf | 2018-09-05 10:37 | 3.5M | |
![[ ]](/icons/layout.gif) | catalogo_algas Salvador.pdf | 2018-09-05 10:36 | 3.5M | |
![[ ]](/icons/layout.gif) | Haas_et_al_2009_nutrients_coral-algae.pdf | 2018-09-05 10:39 | 2.6M | |
![[ ]](/icons/layout.gif) | Duarte_1995-nutrients-SAV.pdf | 2018-09-05 10:37 | 2.6M | |
![[ ]](/icons/layout.gif) | Lapointe,_Littler___Littler._1992.pdf | 2018-09-05 10:44 | 2.4M | |
![[ ]](/icons/unknown.gif) | Santelices.PDF | 2018-09-05 10:51 | 2.3M | |
![[ ]](/icons/layout.gif) | Turf-sedimentos.pdf | 2018-09-05 10:53 | 2.3M | |
![[ ]](/icons/unknown.gif) | lapoint. ALGAL BLOOMS.PDF | 2018-09-05 10:44 | 2.2M | |
![[ ]](/icons/layout.gif) | Stasis or kinesis.pdf | 2018-09-05 10:51 | 2.2M | |
![[ ]](/icons/unknown.gif) | Beltran-Magos et.al. 2005.PDF | 2018-09-05 10:36 | 2.1M | |
![[ ]](/icons/unknown.gif) | Alveal.PDF | 2018-09-05 10:36 | 1.8M | |
![[ ]](/icons/layout.gif) | Algal physiol _ morphol presentación.pdf | 2018-09-05 10:36 | 1.8M | |
![[ ]](/icons/layout.gif) | Mendoza etal. Integración...algas marinas...sur Jalisco. Rev. Mex. Biod. 2011.pdf | 2018-09-05 10:47 | 1.7M | |
![[ ]](/icons/layout.gif) | Taxonomy_20Information.pdf | 2018-09-05 10:52 | 1.7M | |
![[ ]](/icons/layout.gif) | Lubchenko.pdf | 2018-09-05 10:46 | 1.6M | |
![[ ]](/icons/layout.gif) | Peterson___Fry.pdf | 2018-09-05 10:49 | 1.4M | |
![[ ]](/icons/unknown.gif) | Santelices etal. A bank of microscopic.PDF | 2018-09-05 10:51 | 1.4M | |
![[ ]](/icons/unknown.gif) | Santelices et.al.1995.PDF | 2018-09-05 10:51 | 1.4M | |
![[ ]](/icons/unknown.gif) | Aboal 2003.PDF | 2018-09-05 10:35 | 1.3M | |
![[ ]](/icons/layout.gif) | BBAmmoniaRpt2000.pdf | 2018-09-05 10:36 | 1.2M | |
![[ ]](/icons/unknown.gif) | Kim. Interactions Fucus - Mazzaella.PDF | 2018-09-05 10:42 | 1.2M | |
![[ ]](/icons/unknown.gif) | Interactions Fucus - Mazzaella.PDF | 2018-09-05 10:39 | 1.2M | |
![[ ]](/icons/layout.gif) | Algal ecology presentación.pdf | 2018-09-05 10:36 | 1.1M | |
![[ ]](/icons/layout.gif) | Collado-Vides-et-al-2011bot.2011.pdf | 2018-09-05 10:37 | 1.1M | |
![[ ]](/icons/layout.gif) | Collado-Vides-et-al-2011bot.2011.046[1].pdf | 2018-09-05 10:37 | 1.1M | |
![[ ]](/icons/layout.gif) | Collado-Vides-et-al-2011bot.2011.046.pdf | 2018-09-05 10:36 | 1.1M | |
![[ ]](/icons/layout.gif) | Grzebyk origen plastidio.pdf | 2018-09-05 10:39 | 1.1M | |
![[ ]](/icons/layout.gif) | Airoldi _ Virgilio. 1998.pdf | 2018-09-05 10:35 | 1.0M | |
![[ ]](/icons/layout.gif) | Macroalgas con ciclo de alternancia vs. un banco de semillas.pdf | 2018-09-05 10:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Mejía Niño _ Garzón Ferrerira. Dinámica de las interacciones alga-coral...Bol. Invest. Mar. Cost. 2003.pdf | 2018-09-05 10:47 | 1.0M | |
![[ ]](/icons/layout.gif) | seaweed farming impacts in tropic.pdf | 2018-09-05 10:51 | 1.0M | |
![[ ]](/icons/layout.gif) | Jompa y McCook Coral algal competition.pdf | 2018-09-05 09:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Millar_Payri,2006.pdf | 2018-09-05 09:56 | 966K | |
![[ ]](/icons/layout.gif) | Kirkman y Kendrick. Ecological significance...J.A.Phy. 1997.pdf | 2018-09-05 09:55 | 910K | |
![[ ]](/icons/layout.gif) | Cyanophyta presentación.pdf | 2018-09-05 09:54 | 879K | |
![[ ]](/icons/unknown.gif) | Montecinos etal. 2011. Mazzaella laminarioides spp. tres especies crípticas con historias demográficas distintas. abstracts..PDF | 2018-09-05 09:56 | 850K | |
![[ ]](/icons/unknown.gif) | Santelices. Ecological resposes.PDF | 2018-09-05 09:57 | 827K | |
![[ ]](/icons/unknown.gif) | Santelices. 2004.PDF | 2018-09-05 09:57 | 827K | |
![[ ]](/icons/layout.gif) | santelices _oliger 1981.pdf | 2018-09-05 09:57 | 809K | |
![[ ]](/icons/unknown.gif) | Casares _ Faugeron. 2011..PDF | 2018-09-05 09:54 | 805K | |
![[ ]](/icons/layout.gif) | Atkinson___Smith_1983.pdf | 2018-09-05 09:53 | 805K | |
![[ ]](/icons/layout.gif) | Fernandez _ Nell. Zonación del fitobentos intermareal... Inv. Pesq. 1982.pdf | 2018-09-05 09:54 | 786K | |
![[ ]](/icons/layout.gif) | Diaz-Pulido_McCook 2008.pdf | 2018-09-05 09:54 | 773K | |
![[ ]](/icons/layout.gif) | respuestas algales unitarias, clonales y coalescentes Santel.pdf | 2018-09-05 09:56 | 771K | |
![[ ]](/icons/layout.gif) | Kang etal. Food web structure of a restored macroalgal bed...Mar Biol. 2008.pdf | 2018-09-05 09:55 | 770K | |
![[ ]](/icons/layout.gif) | Macroalgas, macroinvertebrados, disturbio.pdf | 2018-09-05 09:55 | 750K | |
![[ ]](/icons/layout.gif) | Radiación fotosintéticamente activa.pdf | 2018-09-05 09:56 | 719K | |
![[ ]](/icons/layout.gif) | Cetz Navarro etal. Nuevos registros de algas...Hidobiológica 2008.pdf | 2018-09-05 09:54 | 700K | |
![[ ]](/icons/layout.gif) | Dethier _ Williams. Seasonal stresses shift optimal intertidal algae habitats. Mar Biol 2009.pdf | 2018-09-05 09:54 | 674K | |
![[ ]](/icons/layout.gif) | Boyer,Fong,Artmitage2005.pdf | 2018-09-05 09:53 | 666K | |
![[ ]](/icons/layout.gif) | Trono. Seaweeds.pdf | 2018-09-05 09:57 | 627K | |
![[ ]](/icons/layout.gif) | Seaweeds FAO.pdf | 2018-09-05 09:57 | 627K | |
![[ ]](/icons/layout.gif) | mcMinn etal. In situ net primary productivity and photosynthesis of Antartic sea ice algal, phytoplancton and nenthic algal communities. Mar Biol 2010.pdf | 2018-09-05 09:56 | 621K | |
![[ ]](/icons/layout.gif) | PR05.pdf | 2018-09-05 09:56 | 615K | |
![[ ]](/icons/layout.gif) | EPA2011_final_report_v2.0_-_nutirents_algae.pdf | 2018-09-05 09:54 | 612K | |
![[ ]](/icons/layout.gif) | Functional Morphology of Turf Hay.pdf | 2018-09-05 09:54 | 605K | |
![[ ]](/icons/layout.gif) | disturbance_eutrophication-2207.pdf | 2018-09-05 09:54 | 603K | |
![[ ]](/icons/layout.gif) | vasquez_westerrmeir_hybrob.pdf | 2018-09-05 09:57 | 600K | |
![[ ]](/icons/layout.gif) | Portada FAO.pdf | 2018-09-05 09:56 | 585K | |
![[ ]](/icons/layout.gif) | Godl multicel-Volvox.pdf | 2018-09-05 09:55 | 576K | |
![[ ]](/icons/layout.gif) | macroalgas Camanchaca 1999.pdf | 2018-09-05 09:55 | 575K | |
![[ ]](/icons/layout.gif) | Burkepile_Hay_2009_Nutirent_algae_coral.pdf | 2018-09-05 09:54 | 573K | |
![[ ]](/icons/layout.gif) | subtidalassamblages Australia.pdf | 2018-09-05 09:57 | 561K | |
![[ ]](/icons/unknown.gif) | Disiccation protection.PDF | 2018-09-05 09:54 | 558K | |
![[ ]](/icons/layout.gif) | Toth etal. Mesoherbivores reduce net growth...seaweeds. oecologia. 2007.pdf | 2018-09-05 09:57 | 531K | |
![[ ]](/icons/layout.gif) | Leinfelder_et al_2003.pdf | 2018-09-05 09:55 | 514K | |
![[ ]](/icons/layout.gif) | Collado-Vides_et_al_2011-Bot.MAr-BlackPoint.pdf | 2018-09-05 09:54 | 507K | |
![[ ]](/icons/layout.gif) | Marine Botany presentación.pdf | 2018-09-05 09:56 | 501K | |
![[ ]](/icons/layout.gif) | Duarte_1990[1].pdf | 2018-09-05 09:54 | 497K | |
![[ ]](/icons/unknown.gif) | Tissue Type Matters Selective Herbivory on Different Life History Stages of an Isomorphic algae.PDF | 2018-09-05 09:57 | 495K | |
![[ ]](/icons/layout.gif) | Lin___Fong._2008.pdf | 2018-09-05 09:55 | 490K | |
![[ ]](/icons/layout.gif) | Fong-bioindicators_2008[1].pdf | 2018-09-05 09:54 | 489K | |
![[ ]](/icons/layout.gif) | Turf vs erizos.pdf | 2018-09-05 09:57 | 472K | |
![[ ]](/icons/layout.gif) | Agardh 1847.pdf | 2018-09-05 09:53 | 469K | |
![[ ]](/icons/layout.gif) | Reyes-Prieto2006[1].pdf | 2018-09-05 09:56 | 454K | |
![[ ]](/icons/layout.gif) | Reyes-Prieto_20et_20al_20Algae_2006[1].pdf | 2018-09-05 09:56 | 453K | |
![[ ]](/icons/layout.gif) | Daly _ Konar. Effects of macroalgal structutre... Mar Biol. 2008.pdf | 2018-09-05 09:54 | 451K | |
![[ ]](/icons/layout.gif) | Macroalgas, experimentos en arena.pdf | 2018-09-05 09:55 | 446K | |
![[ ]](/icons/unknown.gif) | Bolam 2000.PDF | 2018-09-05 09:53 | 446K | |
![[ ]](/icons/unknown.gif) | Stressed but not defenceless.PDF | 2018-09-05 09:57 | 443K | |
![[ ]](/icons/unknown.gif) | Padilla et.al.2010.PDF | 2018-09-05 09:56 | 436K | |
![[ ]](/icons/layout.gif) | Lista macroalgas Cuba-2005.pdf | 2018-09-05 09:55 | 418K | |
![[ ]](/icons/layout.gif) | Macroalgas eutroficación, trópicos, Taiwán.pdf | 2018-09-05 09:55 | 402K | |
![[ ]](/icons/layout.gif) | 2005_Schaffelke Calidad del agua.pdf | 2018-09-05 09:53 | 400K | |
![[ ]](/icons/layout.gif) | Pin_o_n_etal._2009.pdf | 2018-09-05 09:56 | 396K | |
![[ ]](/icons/unknown.gif) | Bigler et.al.2010.PDF | 2018-09-05 09:53 | 394K | |
![[ ]](/icons/layout.gif) | Plant Physiol.-1998-Bhattacharya-9-15.pdf | 2018-09-05 09:56 | 381K | |
![[ ]](/icons/unknown.gif) | History currents.PDF | 2018-09-05 09:55 | 379K | |
![[ ]](/icons/layout.gif) | Kapraun2005algas.pdf | 2018-09-05 09:55 | 363K | |
![[ ]](/icons/layout.gif) | Kapraun2005.pdf | 2018-09-05 09:55 | 363K | |
![[ ]](/icons/layout.gif) | Santelices_1999_How many kinds of individual are there.pdf | 2018-09-05 09:57 | 362K | |
![[ ]](/icons/layout.gif) | 1999. Santelices_1999_How many kinds of individual are there.pdf | 2018-09-05 09:53 | 362K | |
![[ ]](/icons/layout.gif) | Liman. Competition macroalgae-corals herbivore exclusion...Coral Reefs 2001.pdf | 2018-09-05 09:55 | 347K | |
![[ ]](/icons/unknown.gif) | Thiel 2003.PDF | 2018-09-05 09:57 | 344K | |
![[ ]](/icons/layout.gif) | Santelices et.al. 2010.pdf | 2018-09-05 09:56 | 344K | |
![[ ]](/icons/unknown.gif) | Cui et.al.2010.PDF | 2018-09-05 09:54 | 344K | |
![[ ]](/icons/layout.gif) | Wright etal. Native species behaviour mitigates the impact of habitat forming incasive seawedd. Oecologia 2010.pdf | 2018-09-05 09:57 | 341K | |
![[ ]](/icons/unknown.gif) | Pedersen etal. Seaweeds of the litoral.PDF | 2018-09-05 09:56 | 341K | |
![[ ]](/icons/layout.gif) | macroalgas y pastos marinos utiles bioindicadores de contaminacion.pdf | 2018-09-05 09:55 | 333K | |
![[ ]](/icons/layout.gif) | Boubonari et.al. 2009.pdf | 2018-09-05 09:53 | 329K | |
![[ ]](/icons/layout.gif) | Armitage,_Frankovich___Fourqurean._2006.pdf | 2018-09-05 09:53 | 328K | |
![[ ]](/icons/layout.gif) | Contenido FAO.pdf | 2018-09-05 09:54 | 320K | |
![[ ]](/icons/unknown.gif) | VanAlstyne et.al. 2001.PDF | 2018-09-05 09:57 | 314K | |
![[ ]](/icons/layout.gif) | Costa etal. Spatial and Seasonal Distribution of Seaweeds on Coral Reefs from Brazil Botanica Marina 2002.pdf | 2018-09-05 09:54 | 309K | |
![[ ]](/icons/layout.gif) | esporas algales-movimiento de agua.pdf | 2018-09-05 09:54 | 306K | |
![[ ]](/icons/layout.gif) | MARINA - R. Gordon Æ S. H. Brawley. 2004. Liberación de espo.pdf | 2018-09-05 09:55 | 306K | |
![[ ]](/icons/layout.gif) | Gordon _ Brawley. Effects of water motion. Mar.Biol.2004.pdf | 2018-09-05 09:55 | 306K | |
![[ ]](/icons/layout.gif) | Gordon Æ S. H. Brawley. 2004. Liberación de espo.pdf | 2018-09-05 09:55 | 306K | |
![[ ]](/icons/unknown.gif) | GRIMM clorofila.PDF | 2018-09-05 09:55 | 306K | |
![[ ]](/icons/layout.gif) | respalgas.pdf | 2018-09-05 09:56 | 297K | |
![[ ]](/icons/layout.gif) | Macroalgas, variación genética, isoenzimas.pdf | 2018-09-05 09:55 | 280K | |
![[ ]](/icons/layout.gif) | Caracterización de algas.pdf | 2018-09-05 09:53 | 279K | |
![[ ]](/icons/unknown.gif) | Santelices etal. Banks of microscopic forms and survival to darkness of propagules and.PDF | 2018-09-05 09:56 | 273K | |
![[ ]](/icons/layout.gif) | Turf, sedimentos y nutrientes.pdf | 2018-09-05 09:57 | 273K | |
![[ ]](/icons/layout.gif) | Kraufvelin etal. Nutrient addition ..intertidal communities. Ecosystems 2007.pdf | 2018-09-05 09:55 | 271K | |
![[ ]](/icons/unknown.gif) | Dhiab et.al.2010.PDF | 2018-09-05 09:54 | 269K | |
![[ ]](/icons/layout.gif) | South AfricaCTMBREAR-186.pdf | 2018-09-05 09:57 | 261K | |
![[ ]](/icons/layout.gif) | Pizarro etal. An economic assessment of algal turf scrubber technology for treatment of dairy manure effluent.pdf | 2018-09-05 09:56 | 254K | |
![[ ]](/icons/unknown.gif) | Collado. Clonal architecture in marine macroalgae ecological and evolutionary perspectives. Evol Ecol. 2002.PDF | 2018-09-05 09:54 | 250K | |
![[ ]](/icons/unknown.gif) | Zhou et.al.2010.PDF | 2018-09-05 09:57 | 247K | |
![[ ]](/icons/layout.gif) | Capitulo_5 cultivo algas macroscopicas.pdf | 2018-09-05 09:53 | 243K | |
![[ ]](/icons/unknown.gif) | Navarro etal. UVB effects on early developmental stages of commercially important carragenophta. J. app. Phy. 2008.PDF | 2018-09-05 09:56 | 241K | |
![[ ]](/icons/unknown.gif) | J. Navarro etal. UVB effects on early developmental stages of commercially important carragenophta. J. app. Phy. 2008.PDF | 2018-09-05 09:55 | 241K | |
![[ ]](/icons/layout.gif) | Cianciola etal. using molecular assisted alpha taxonomy...red algal biodiversity. Diversity 2010.pdf | 2018-09-05 09:54 | 240K | |
![[ ]](/icons/layout.gif) | Godsell2005_disturbance_canopy_macroalgae.pdf | 2018-09-05 09:54 | 239K | |
![[ ]](/icons/layout.gif) | wuest_sinniger 2004.pdf | 2018-09-05 09:57 | 238K | |
![[ ]](/icons/layout.gif) | razeralgaCoral-depredación.pdf | 2018-09-05 09:56 | 237K | |
![[ ]](/icons/unknown.gif) | Verlag 2003.PDF | 2018-09-05 09:57 | 228K | |
![[ ]](/icons/layout.gif) | Valdivia _ de la Guardia 2004.pdf | 2018-09-05 09:57 | 227K | |
![[ ]](/icons/layout.gif) | Macroalgas, Sonora. Aguilar-Rosas et al 2002.pdf | 2018-09-05 09:55 | 223K | |
![[ ]](/icons/unknown.gif) | Hauer2010.PDF | 2018-09-05 09:55 | 217K | |
![[ ]](/icons/layout.gif) | santelices2011.pdf | 2018-09-05 09:56 | 211K | |
![[ ]](/icons/layout.gif) | PalacinEsp1.pdf | 2018-09-05 09:56 | 207K | |
![[ ]](/icons/layout.gif) | PalacinEsp.pdf | 2018-09-05 09:56 | 207K | |
![[ ]](/icons/layout.gif) | Ati-Hellal et al. 2007.pdf | 2018-09-05 09:53 | 204K | |
![[ ]](/icons/layout.gif) | Ati-Hellal et. al. 2007.pdf | 2018-09-05 09:53 | 204K | |
![[ ]](/icons/layout.gif) | Frangoudes 2011.pdf | 2018-09-05 09:54 | 203K | |
![[ ]](/icons/layout.gif) | Turfs dominados por Corallinales.pdf | 2018-09-05 09:57 | 203K | |
![[ ]](/icons/layout.gif) | Diversity-nutrients_macroalgae2004.pdf | 2018-09-05 09:54 | 202K | |
![[ ]](/icons/layout.gif) | Conley_et_al_2009[1]_controling_euthrophication.pdf | 2018-09-05 09:54 | 202K | |
![[ ]](/icons/layout.gif) | Patrones fractales del asentamiento algal.pdf | 2018-09-05 09:56 | 193K | |
![[ ]](/icons/layout.gif) | Coleman. The role of recruitment in structuring patterns os small-scale spatial variability in intertidal and subtidal algal turfs. JEMBE 2003.pdf | 2018-09-05 09:54 | 193K | |
![[ ]](/icons/layout.gif) | Frangoudes_2011_Management_Seaweeds_Cahiers_Biologie_Marine.pdf | 2018-09-05 09:54 | 191K | |
![[ ]](/icons/layout.gif) | Golberg etal. Adaptative cluster sampling rare macrolagae. Mar. Biol. 2007.pdf | 2018-09-05 09:54 | 188K | |
![[ ]](/icons/layout.gif) | Microalgas, variación estacional, distribución, sedimentos, .pdf | 2018-09-05 09:55 | 187K | |
![[ ]](/icons/layout.gif) | clanahanAlgCoral.pdf | 2018-09-05 09:53 | 185K | |
![[ ]](/icons/layout.gif) | MclanahanBelizealgacoral.pdf | 2018-09-05 09:55 | 185K | |
![[ ]](/icons/layout.gif) | Algal_growth_and_nutrients-2002[1].pdf | 2018-09-05 09:53 | 183K | |
![[ ]](/icons/unknown.gif) | Piriz et.al.2003.PDF | 2018-09-05 09:56 | 177K | |
![[ ]](/icons/layout.gif) | Monogrph. applied mar. Algae India.pdf | 2018-09-05 09:56 | 167K | |
![[ ]](/icons/layout.gif) | Sherwood.pdf | 2018-09-05 09:57 | 167K | |
![[ ]](/icons/layout.gif) | Fong06-EpiphyteMAShift.pdf | 2018-09-05 09:54 | 165K | |
![[ ]](/icons/layout.gif) | Gray_et_al_2000_nutrient_assimilative.pdf | 2018-09-05 09:55 | 162K | |
![[ ]](/icons/unknown.gif) | Lu et.al.2010.PDF | 2018-09-05 09:55 | 157K | |
![[ ]](/icons/layout.gif) | D. Carol S. Thornber. Functional properties of the isomorphic biphasic algal life cycle. Integr. Comp. Biol.-2006-Thornber-605-14[1].pdf | 2018-09-05 09:54 | 157K | |
![[ ]](/icons/layout.gif) | Carol S. Thornber. Functional properties of the isomorphic biphasic algal life cycle. Integr. Comp. Biol.-2006-Thornber-605-14[1].pdf | 2018-09-05 09:53 | 157K | |
![[ ]](/icons/layout.gif) | variación antifouling.pdf | 2018-09-05 09:57 | 149K | |
![[ ]](/icons/layout.gif) | Distribucion macroalgas Mexico.pdf | 2018-09-05 09:54 | 147K | |
![[ ]](/icons/layout.gif) | grazers-nutrients2004.pdf | 2018-09-05 09:55 | 144K | |
![[ ]](/icons/layout.gif) | Purton cloroplas-algas.pdf | 2018-09-05 09:56 | 141K | |
![[ ]](/icons/unknown.gif) | Anderson et.al. 2005.PDF | 2018-09-05 09:53 | 136K | |
![[ ]](/icons/layout.gif) | Flujos arriba abajo.pdf | 2018-09-05 09:54 | 135K | |
![[ ]](/icons/layout.gif) | Metabolismo algal, Raven.pdf | 2018-09-05 09:55 | 134K | |
![[ ]](/icons/layout.gif) | Review Classification.pdf | 2018-09-05 09:56 | 132K | |
![[ ]](/icons/unknown.gif) | MOESRUP tax algas.PDF | 2018-09-05 09:55 | 131K | |
![[ ]](/icons/unknown.gif) | Nabivailo _ TitlyanovCompetitive relationships.PDF | 2018-09-05 09:56 | 129K | |
![[ ]](/icons/layout.gif) | farming Kappaphycus longline.pdf | 2018-09-05 09:54 | 122K | |
![[ ]](/icons/layout.gif) | macroalgas e invertebrados asociados.pdf | 2018-09-05 09:55 | 119K | |
![[ ]](/icons/layout.gif) | Monitoreo Macroalgas.pdf | 2018-09-05 09:55 | 116K | |
![[ ]](/icons/layout.gif) | Macroalgas, monitoreo de diversidad.pdf | 2018-09-05 09:55 | 116K | |
![[ ]](/icons/layout.gif) | MACROALGAL Necchi-Junior_20O.pdf | 2018-09-05 09:55 | 111K | |
![[ ]](/icons/layout.gif) | Portada_Contenido_Manual[1].pdf | 2018-09-05 09:56 | 101K | |
![[ ]](/icons/layout.gif) | Filogenia de Algas, libro.pdf | 2018-09-05 09:54 | 98K | |
![[ ]](/icons/layout.gif) | Pizarro etal. Nitrogen _ phosphorous removal rates using algal turfs groen with dairy manure. J. Appl. Phycol 2002.pdf | 2018-09-05 09:56 | 97K | |
![[ ]](/icons/unknown.gif) | MOESRUPT Fiolog algas.PDF | 2018-09-05 09:55 | 95K | |
![[ ]](/icons/unknown.gif) | Fei2004.PDF | 2018-09-05 09:54 | 85K | |
![[ ]](/icons/layout.gif) | Especies algas Cuba.pdf | 2018-09-05 09:54 | 82K | |
![[ ]](/icons/unknown.gif) | Qin et.al. 2004.PDF | 2018-09-05 09:56 | 81K | |
![[ ]](/icons/layout.gif) | Macroalgas, biotecnología molecular.pdf | 2018-09-05 09:55 | 81K | |
![[ ]](/icons/unknown.gif) | Tseng2001.PDF | 2018-09-05 09:57 | 78K | |
![[ ]](/icons/layout.gif) | Cavalier2 Evolución clorop.pdf | 2018-09-05 09:53 | 76K | |
![[ ]](/icons/unknown.gif) | Santelices. Implications of clonal and chimeric-type thallus organization on seaweed.PDF | 2018-09-05 09:56 | 74K | |
![[ ]](/icons/layout.gif) | Burdick.pdf | 2018-09-05 09:53 | 53K | |
![[ ]](/icons/layout.gif) | Phyton algas.pdf | 2018-09-05 09:56 | 48K | |
![[ ]](/icons/layout.gif) | Tittley _ Neto. A provisional classification of algal characterised rocky shore biotopes in Azores. Hydrobiologia 2000.pdf | 2018-09-05 09:57 | 45K | |
![[ ]](/icons/unknown.gif) | Zemke-White_Ohno1999.PDF | 2018-09-05 09:57 | 44K | |
![[ ]](/icons/layout.gif) | Fogg_Harmful_Algae(2002).pdf | 2018-09-05 09:54 | 41K | |
![[ ]](/icons/unknown.gif) | Functional Morphology of Turf Hay.docx | 2018-11-17 14:42 | 40K | |
![[ ]](/icons/layout.gif) | Santelices 2004.pdf | 2018-09-05 09:56 | 40K | |
![[ ]](/icons/unknown.gif) | Fernandez _ Nell. Zonación del fitobentos intermareal... Inv. Pesq. 1982.docx | 2018-11-17 14:26 | 37K | |
![[ ]](/icons/layout.gif) | revision1.pdf | 2018-09-05 09:56 | 30K | |
|