![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | tai.1962.8.167.pdf | 2019-02-22 12:56 | 2.6M | |
| m165p271.pdf | 2019-02-22 12:56 | 1.0M | |
| m165p271 (1).pdf | 2019-02-22 12:56 | 1.0M | |
| m133p241.pdf | 2019-02-22 12:56 | 1.2M | |
| m022p291.pdf | 2019-02-22 12:55 | 1.3M | |
| lo.1964.9.2.0270.pdf | 2019-02-22 12:49 | 352K | |
| j.1550-7408.1968.tb02154.x.pdf | 2019-02-22 12:55 | 5.9M | |
| j.1550-7408.1968.tb02098.x.pdf | 2019-02-22 12:55 | 2.2M | |
| j.1529-8817.2002.01152.x.pdf | 2019-02-22 12:49 | 233K | |
| download.pdf | 2019-02-22 12:49 | 517K | |
| download (2).pdf | 2019-02-22 12:55 | 6.3M | |
| download (1).pdf | 2019-02-22 12:55 | 3.3M | |
| art00017.pdf | 2019-02-22 12:49 | 23K | |
| [Botanica Marina] Phytogeography of the Fucales and their Seasonal Growth.pdf | 2019-02-22 12:48 | 2.0M | |
| [Botanica Marina] Observations on the Marine Unicellular Endophyte Chlorochytrium porphyrae (Chlorophyceae).pdf | 2019-02-22 12:48 | 1.9M | |
| [Botanica Marina] Notes on the benthic marine algae of Puerto Rico VIII. Additions to the flora.pdf | 2019-02-22 12:48 | 461K | |
| [Botanica Marina] Life Forms in the Algae.pdf | 2019-02-22 12:49 | 2.0M | |
| [Botanica Marina] Checklist of Mediterranean Seaweeds. III. Rhodophyceae Rabenh. 1. Ceramiales Oltm..pdf | 2019-02-22 12:48 | 268K | |
| [Botanica Marina] An Updated and Annotated List of Marine Brown Algae (Phaeophyceae) of the Caribbean Coast of the Republic of Panama.pdf | 2019-02-22 12:48 | 371K | |
| [Botanica Marina] A List of Marine Algae from Libya.pdf | 2019-02-22 12:48 | 2.0M | |
| [Botanica Marina] A Checklist of the Seaweeds of the Mediterranean and Atlantic Coasts of Morocco.IV. Rhodophyceae - Ceramiales.pdf | 2019-02-22 12:48 | 152K | |
| [Botanica Marina] A Checklist of the Seaweeds of the Mediterranean and Atlantic Coasts of Morocco.IV. Rhodophyceae - Ceramiales - copia.pdf | 2019-02-22 12:48 | 152K | |
| Woelkerling1976_Article_Sedgwick-rafterCellCountsAProc.pdf | 2019-02-22 12:50 | 699K | |
| Woelkerling-Gough1976_Article_WisconsinDesmidsIIIDesmidCommu.pdf | 2019-02-22 12:57 | 1.3M | |
| West_et_al-1902-Transactions_of_the_Linnean_Society_of_London._2nd_Series__Botany.pdf | 2019-02-22 12:57 | 3.6M | |
| West_et_al-1895-Transactions_of_the_Linnean_Society_of_London._2nd_Series__Botany.pdf | 2019-02-22 12:57 | 3.6M | |
| Walne-Arnott1967_Article_TheComparativeUltrastructureAn.pdf | 2019-02-22 12:57 | 8.1M | |
| V073N4_229.pdf | 2019-02-22 12:50 | 371K | |
| The tolerance of Stigeoclonium tenue K tz To heavy metals in South Wales.pdf | 2019-02-22 12:50 | 418K | |
| The Characeae of Indiana - A Preliminary Report.pdf | 2019-02-22 12:57 | 4.0M | |
| Submerged vegetation of the Rotorua and Waikato lakes.pdf | 2019-02-22 12:56 | 1.2M | |
| Some New and Uncommon Chlamydomonas Species from New Zealand.pdf | 2019-02-22 12:57 | 1.2M | |
| Schindler-1978-Limnology_and_Oceanography.pdf | 2019-02-22 12:50 | 958K | |
| Schiel1990_Article_MacroalgalAssemblagesInNewZeal.pdf | 2019-02-22 12:56 | 1.3M | |
| Santelices1993_Article_EffectsOfStockLoadingAndPlanti.pdf | 2019-02-22 12:49 | 516K | |
| Santelices1990_Article_PatternsOfOrganizationsOfInter.pdf | 2019-02-22 12:56 | 2.0M | |
| Santelices1989_Article_EcologicalStudiesForHarvesting.pdf | 2019-02-22 12:50 | 786K | |
| Santelices-Varela1995_Article_RegenerativeCapacityOfGracilar.pdf | 2019-02-22 12:49 | 412K | |
| Santelices-Varela1993_Article_ExudatesFromGracilariaChilensi.pdf | 2019-02-22 12:50 | 521K | |
| Santelices-Ugarte1990_Article_EcologicalDifferencesAmongChil.pdf | 2019-02-22 12:50 | 686K | |
| Søndergaard-Sand-Jensen1979_Article_Physico-chemicalEnvironmentPhy.pdf | 2019-02-22 12:50 | 768K | |
| Potts-Whitton1979_Article_PHAndEhOnAldabraAtoll1Comparis.pdf | 2019-02-22 12:49 | 497K | |
| On processing field and culture samples of desmids Desmidiales chlorophyta for scanning electron microscopy.pdf | 2019-02-22 12:50 | 661K | |
| On Staurastrum botrophilum Wolle a rare and inadequately described desmid.pdf | 2019-02-22 12:50 | 507K | |
| Oesel1978_Article_OligotrophicationAndEutrophica.pdf | 2019-02-22 12:50 | 877K | |
| Nuclear small subunit ribosomal RNA gene sequences from representative Ceramiaceae Ceramiales Rhodophyta.pdf | 2019-02-22 12:50 | 774K | |
| Notes sur l Arthrodesmus impar Jacobsen Gr nblad et ses variations suivies de remarques sur la d limitation des genres Arthrodesmus et Xanthidium.pdf | 2019-02-22 12:49 | 738K | |
| Notes on distribution and bio-ecology of Characeae.pdf | 2019-02-22 12:49 | 853K | |
| Nitella capillata A. Br. in North Carolina.pdf | 2019-02-22 12:56 | 1.4M | |
| Naef1978_Article_SurLesStaurastrumDuLacLémanOnT.pdf | 2019-02-22 12:49 | 806K | |
| Morphological and taxonomic studies on Antarctic Ceramiaceae Rhodophyceae I Antarcticothamnion polysporum gen et sp nov.pdf | 2019-02-22 12:56 | 1.9M | |
| Molecular evidence for an interfamilial laminarialean cross.pdf | 2019-02-22 12:49 | 493K | |
| Molecular 12-02-2019.pdf | 2019-02-22 12:49 | 65K | |
| Miller2000_Article_CoralRecruitmentAndJuvenileMor.pdf | 2019-02-22 12:49 | 220K | |
| MF9780205.pdf | 2019-02-22 12:56 | 4.0M | |
![[ ]](/icons/unknown.gif) | Lucero.xlsx | 2019-02-22 12:49 | 16K | |
| Littler1983_Article_AlgalResistanceToHerbivoryOnAC.pdf | 2019-02-22 12:56 | 1.0M | |
| Lewis-Mei-lan1996_Article_TheSpeciesOfCeramiumCeramiacea.pdf | 2019-02-22 12:49 | 664K | |
| Les Ulothrix marins de Roscoff et le probl me de leur cycle de reproduction.pdf | 2019-02-22 12:49 | 540K | |
| Le cycle de d veloppement des Rhodophyc es et son volution.pdf | 2019-02-22 12:55 | 1.2M | |
| Kunimoto1999_Article_DiscriminationOfPorphyraSpecie.pdf | 2019-02-22 12:49 | 87K | |
| Influence of nutrient deficiency on hair formation in Stigeoclonium.pdf | 2019-02-22 12:49 | 440K | |
| Hern-ndez_et_al-1997-Journal_of_Phycology.pdf | 2019-02-22 12:49 | 917K | |
| Hay1984cultivation_biology_of_gruc.pdf | 2019-02-22 12:49 | 590K | |
| Harper_et_al-2001-Journal_of_Phycology.pdf | 2019-02-22 12:49 | 403K | |
| Häder-Nultsch1971_Article_UntersuchungenZurAbgrenzungDer.pdf | 2019-02-22 12:49 | 773K | |
| Gough-Woelkerling1976_Article_OnTheRemovalAndQuantificationO.pdf | 2019-02-22 12:49 | 324K | |
| Golubić-Kann1967_Article_ZurKlärungDerTaxonomischenBezi.pdf | 2019-02-22 12:55 | 1.2M | |
| Fucusculture2.pdf | 2019-02-22 12:49 | 356K | |
| Friedmann-Kibler1980_Article_NitrogenEconomyOfEndolithicMic.pdf | 2019-02-22 12:49 | 958K | |
| FredSomers-Brown1978_Article_TheAffinityOfTrichomesOfBlue-g.pdf | 2019-02-22 12:49 | 964K | |
| Etiquetas (1).docx | 2019-02-22 12:49 | 46K | |
| Domozych1980_Article_TheComparativeAspectsOfCellWal.pdf | 2019-02-22 12:49 | 658K | |
| Dolzmann-Dolzmann1964_Article_UntersuchungenÜberDieFeinstruk.pdf | 2019-02-22 12:55 | 2.5M | |
| Desmids of the Staurastrum tetracerum group from a eutrophic lake in mid wales.pdf | 2019-02-22 12:49 | 1.0M | |
| Desikachary1970_Article_TaxonomyOfBlue-greenAlgae-prob.pdf | 2019-02-22 12:49 | 346K | |
| Descriptions of new edaphic and aquatic species of Chlorococcum Meneghini Chlorococcales.pdf | 2019-02-22 12:49 | 943K | |
| Crawford1979_Article_FarmPondRestorationUsingCharaV.pdf | 2019-02-22 12:49 | 646K | |
| Coccomyxa parasitica sp nov Coccomyxaceae Chlorococcales a parasite of giant scallops in Newfoundland.pdf | 2019-02-22 12:55 | 1.0M | |
| Clapophora Balls Collected in Steuben County Indiana.pdf | 2019-02-22 12:54 | 1.3M | |
| Claire-West1979_Article_Light-AndElectron-microscopicS.pdf | 2019-02-22 12:55 | 4.4M | |
| Chara Kieneri a new species from Nebraska.pdf | 2019-02-22 12:55 | 1.4M | |
| Bourrelly-Dupuy1973_Article_QuelquesStationsFrançaisesDeGe.pdf | 2019-02-22 12:49 | 266K | |
| Bolch_et_al-1999-Journal_of_Phycology.pdf | 2019-02-22 12:49 | 385K | |
| Blum1956_Article_TheEcologyOfRiverAlgae.pdf | 2019-02-22 12:54 | 2.6M | |
| Avila_et_al_1985.pdf | 2019-02-22 12:49 | 939K | |
| A taxonomic appraisal of Callophyllis and Euthora Rhodophyta.pdf | 2019-02-22 12:49 | 562K | |
| Airoldi2001_Article_DistributionAndMorphologicalVa.pdf | 2019-02-22 12:49 | 152K | |
| Abbott1978_Article_TheUsesOfSeaweedAsFoodInHawaii.pdf | 2019-02-22 12:49 | 303K | |
| 25039131.pdf | 2019-02-22 12:54 | 1.9M | |
| 24926259.pdf | 2019-02-22 12:54 | 1.5M | |
| 4064663.pdf | 2019-02-22 12:54 | 2.3M | |
| 3667999.pdf | 2019-02-22 12:49 | 502K | |
| 3667729.pdf | 2019-02-22 12:54 | 1.7M | |
| 3225243.pdf | 2019-02-22 12:54 | 1.2M | |
| 3224438.pdf | 2019-02-22 12:54 | 1.5M | |
| 3224088.pdf | 2019-02-22 12:54 | 1.1M | |
| 3223154.pdf | 2019-02-22 12:54 | 4.5M | |
| 3222306.pdf | 2019-02-22 12:53 | 3.7M | |
| 2483294.pdf | 2019-02-22 12:49 | 429K | |
| 2483212.pdf | 2019-02-22 12:54 | 2.1M | |
| 2482613.pdf | 2019-02-22 12:49 | 409K | |
| 2470457.pdf | 2019-02-22 12:49 | 748K | |
| 2442248.pdf | 2019-02-22 12:53 | 9.8M | |
| 2441925.pdf | 2019-02-22 12:53 | 5.6M | |
| 2440754.pdf | 2019-02-22 12:53 | 2.9M | |
| 2440315.pdf | 2019-02-22 12:53 | 3.2M | |
| 2440094.pdf | 2019-02-22 12:49 | 933K | |
| 2439085.pdf | 2019-02-22 12:52 | 2.0M | |
| 2424905.pdf | 2019-02-22 12:53 | 1.4M | |
| 2424166.pdf | 2019-02-22 12:49 | 855K | |
| 2418850.pdf | 2019-02-22 12:52 | 1.3M | |
| 1937665.pdf | 2019-02-22 12:49 | 703K | |
| 1936181.pdf | 2019-02-22 12:52 | 2.0M | |
| 1935310.pdf | 2019-02-22 12:52 | 1.4M | |
| 1539622.pdf | 2019-02-22 12:48 | 669K | |
| 1300822.pdf | 2019-02-22 12:48 | 487K | |
| 1219798.pdf | 2019-02-22 12:48 | 558K | |
| 1219605.pdf | 2019-02-22 12:49 | 895K | |
| 1219270.pdf | 2019-02-22 12:52 | 1.1M | |
| 1219167.pdf | 2019-02-22 12:49 | 374K | |
| 1218317.pdf | 2019-02-22 12:48 | 379K | |
| 1217351.pdf | 2019-02-22 12:48 | 585K | |
| 1216032.pdf | 2019-02-22 12:48 | 461K | |
| 424499a.pdf | 2019-02-22 12:48 | 153K | |
| 299944_066_1964.pdf | 2019-02-22 12:52 | 17M | |
| 279210a0.pdf | 2019-02-22 12:51 | 9.6M | |
| 279154.pdf | 2019-02-22 12:48 | 724K | |
| 6613-Article Text-12739-1-10-20130401.pdf | 2019-02-22 12:51 | 1.5M | |
| 1606-Article Text-11368-1-10-20170814.pdf | 2019-02-22 12:51 | 1.6M | |
| 1485.full.pdf | 2019-02-22 12:48 | 818K | |
| 978-94-011-4449-0_8.pdf | 2019-02-22 12:48 | 449K | |
| 978-94-009-4057-4_48.pdf | 2019-02-22 12:48 | 423K | |
| 569.full.pdf | 2019-02-22 12:50 | 1.8M | |
| 532-Article Text-2426-1-10-20060403.pdf | 2019-02-22 12:48 | 528K | |
| 516-Article Text-2345-1-10-20060331.pdf | 2019-02-22 12:48 | 661K | |
| 512-Article Text-2325-1-10-20060331.pdf | 2019-02-22 12:48 | 290K | |
| 478-Article Text-2160-1-10-20060331.pdf | 2019-02-22 12:51 | 1.2M | |
| 474-Article Text-2140-1-10-20060331.pdf | 2019-02-22 12:48 | 245K | |
| 466-Article Text-2105-1-10-20060331.pdf | 2019-02-22 12:48 | 592K | |
| 463-Article Text-2081-1-10-20060331.pdf | 2019-02-22 12:48 | 299K | |
| 437-Article Text-1955-1-10-20060330.pdf | 2019-02-22 12:51 | 1.3M | |
| 408-Article Text-1819-1-10-20060329.pdf | 2019-02-22 12:48 | 592K | |
| 401-Article Text-1786-1-10-20060329.pdf | 2019-02-22 12:48 | 434K | |
| 1-s2.0-S0399178400001328-main.pdf | 2019-02-22 12:48 | 124K | |
| 1-s2.0-S0272771402003220-main.pdf | 2019-02-22 12:48 | 403K | |
| 1-s2.0-S0025326X00001168-main.pdf | 2019-02-22 12:48 | 426K | |
| 1-s2.0-S0022098199000738-main.pdf | 2019-02-22 12:48 | 232K | |
| 1-s2.0-S0022098197000695-main.pdf | 2019-02-22 12:48 | 301K | |
| 1-s2.0-S0003936579800081-main.pdf | 2019-02-22 12:50 | 4.9M | |
| 1-s2.0-030437708390089X-main.pdf | 2019-02-22 12:48 | 712K | |
| 1-s2.0-0304377083900888-main.pdf | 2019-02-22 12:49 | 1.4M | |
| 1-s2.0-0303264778900369-main.pdf | 2019-02-22 12:48 | 633K | |
| 1-s2.0-004484869290227C-main.pdf | 2019-02-22 12:48 | 887K | |
| 1-s2.0-0044848689900264-main.pdf | 2019-02-22 12:50 | 3.9M | |
| 1-s2.0-0025326X72901944-main.pdf | 2019-02-22 12:48 | 322K | |
| 1-s2.0-0022201175900877-main.pdf | 2019-02-22 12:50 | 2.1M | |
| 1-s2.0-0022098189901937-main.pdf | 2019-02-22 12:48 | 888K | |
| 1-s2.0-0022098183901351-main.pdf | 2019-02-22 12:49 | 1.2M | |
| 1-s2.0-0022098173900439-main.pdf | 2019-02-22 12:50 | 1.5M | |
| 099B1979WhittonDonaldsonPotts.pdf | 2019-02-22 12:48 | 954K | |
| 0188-8897-hbio-27-03-315.pdf | 2019-02-22 12:50 | 2.1M | |
| 014318.pdf | 2019-02-22 12:51 | 3.1M | |
| 00238.pdf | 2019-02-22 12:48 | 433K | |
|
|---|